Brussel sprouts
- Group:
- Vegetables, Cabbages
Showing entry for Brussel sprouts
Identification
- Name
- Brussel sprouts
- ID
- 20
- Food group
- Vegetables, Cabbages
Synonyms
No Synonyms
Compounds
| Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|---|
| Carotene-beta |  C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C\C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C | 536.438201803 | C40H56 | Terpenoids | Carotenoids | Publications | Show | |
| Brassicasterol |  CC(C)[C@@H](C)\C=C\[C@@H](C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C | 398.354866101 | C28H46O | Terpenoids | Phytosterols | Publications | Show | |
| Campesterol |  [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](C)C(C)C | 400.370516166 | C28H48O | Terpenoids | Phytosterols | Publications | Show | |
| Sitostanol-beta |  CC[C@H](CC[C@@H](C)C1CCC2C3CCC4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)C(C)C | 416.401816294 | C29H52O | Terpenoids | Phytosterols | Publications | Show | |
| Sitosterol-beta |  CC[C@H](CC[C@@H](C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)C(C)C | 414.38616623 | C29H50O | Terpenoids | Phytosterols | Publications | Show | |
| Stigmasterol |  CC[C@H](\C=C\[C@@H](C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C)C(C)C | 412.370516166 | C29H48O | Terpenoids | Phytosterols | Publications | Show | |
| (+)-Pinoresinol |  [H][C@@]12CO[C@@H](C3=CC=C(O)C(OC)=C3)[C@]1([H])CO[C@H]2C1=CC(OC)=C(O)C=C1 | 358.141638428 | C20H22O6 | Polyphenols | Lignans | Publications | Show | |
| (+)-Lariciresinol |  COC1=C(O)C=CC(C[C@H]2CO[C@@H]([C@H]2CO)C2=CC(OC)=C(O)C=C2)=C1 | 360.157288493 | C20H24O6 | Polyphenols | Lignans | Publications | Show | |
| Neoglucobrassicin |  CON1C=C(C\C(S[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)=N/OS(O)(=O)=O)C2=C1C=CC=C2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Progoitrin |  [H][C@@](O)(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O)C=C | 388.037761712 | C11H18NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconasturtiin |  OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 423.065773608 | C15H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Sinigrin |  OCC1O[C@@H](S\C(CC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 359.034473479 | C10H17NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoiberin |  CS(=O)CCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 422.02548295 | C11H20NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| 4-Hydroxyglucobrassicin |  OCC1O[C@@H](S\C(CC2=CNC3=C2C(O)=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 464.0559372 | C16H20N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| 4-Methoxyglucobrassicin |  COC1=CC=CC2=C1C(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O)=CN2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoraphanin |  CS(=O)CCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 436.041133014 | C12H22NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapin |  OCC1O[C@@H](S\C(CCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 373.050123544 | C11H19NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicin |  OCC1O[C@@H](S\C(CC2=CNC3=C2C=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 448.06102258 | C16H20N2O9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Secoisolariciresinol |  COC1=C(O)C=CC(C[C@@H](CO)[C@H](CO)CC2=CC(OC)=C(O)C=C2)=C1 | 362.172938557 | C20H26O6 | Polyphenols | Lignans | Publications | Show | |
| Trigonelline |  C[N+]1=CC=CC(=C1)C([O-])=O | 137.047678469 | C7H7NO2 | N-containing compounds | Alkaloids | Publications | Show | |
| 3-O-Caffeoylquinic acid |  [H]\C(=C(\[H])C1=CC(O)=C(O)C=C1)C(=O)OC1CC(O)(CC(O)C1O)C(O)=O | 354.09508216 | C16H18O9 | Polyphenols | Phenolic acids | Publications | Show | |
| 3-p-Coumaroylquinic acid |  OC1CC(O)(CC(OC(=O)\C=C\C2=CC=C(O)C=C2)C1O)C(O)=O | 338.10016754 | C16H18O8 | Polyphenols | Phenolic acids | Publications | Show | |
| 3,3′-Diindolylmethane |  C(C1=CNC2=C1C=CC=C2)C1=CNC2=C1C=CC=C2 | 246.115698459 | C17H14N2 | N-containing compound metabolites | Miscellaneous N-containing compound metabolites | Publications | Show |
Related Metabolites
| Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|---|
| 3-O-Caffeoylquinic acid | [H]\C(=C(\[H])C1=CC(O)=C(O)C=C1)C(=O)OC1CC(O)(CC(O)C1O)C(O)=O | 354.09508216 | C16H18O9 | Polyphenols | Phenolic acids | Show | ||
| Retinal |  C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=O | 284.214015522 | C20H28O | Terpenoid metabolites | Carotenoid metabolites | Show | ||
| Iberin |  CS(=O)CCCN=C=S | 163.012556262 | C5H9NOS2 | N-containing compounds | Isothiocyanates | Show | ||
| Sulforaphane-cysteine |  [H]OC(=O)C([H])(N([H])[H])C([H])([H])SC(=S)N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])S(=O)C([H])([H])[H] | 298.04795597 | C9H18N2O3S3 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||
| Erucin-glutathione |  | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||||
| Sulforaphane-glutathione |  [H]OC(=O)C([H])([H])N([H])C(=O)C([H])(N([H])C(=O)C([H])([H])C([H])([H])C([H])(N([H])[H])C(=O)O[H])C([H])([H])SC(=S)N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])S(=O)C([H])([H])[H] | 484.11201278 | C16H28N4O7S3 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||
| Sulforaphane-cysteine-glycine |  [H]OC(=O)C([H])([H])N([H])C(=O)[C@@]([H])(N([H])[H])C([H])([H])SC(=S)N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[S@](=O)C([H])([H])[H] | 355.06941969 | C11H21N3O4S3 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||
| 2-thiothiazolidine-4-carboxylic acid |  [H][C@]1(CSC(S)=N1)C(O)=O | 162.976170753 | C4H5NO2S2 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||
| 3,3′-Diindolylmethane | C(C1=CNC2=C1C=CC=C2)C1=CNC2=C1C=CC=C2 | 246.115698459 | C17H14N2 | N-containing compound metabolites | Miscellaneous N-containing compound metabolites | Show | ||
| Sulforaphane-N-acetyl-L-cysteine |  CC(=O)NC(CSC(=S)NCCCCS(C)=O)C(O)=O | 340.058520654 | C11H20N2O4S3 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||
| Sulforaphane |  CS(=O)CCCCN=C=S | 177.028206326 | C6H11NOS2 | N-containing compounds | Isothiocyanates | Show | ||
| Glucoraphanin | CS(=O)CCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 436.041133014 | C12H22NO10S3 | N-containing compounds | Glucosinolates | Show | ||
| Secoisolariciresinol | COC1=C(O)C=CC(C[C@@H](CO)[C@H](CO)CC2=CC(OC)=C(O)C=C2)=C1 | 362.172938557 | C20H26O6 | Polyphenols | Lignans | Show | ||
| Enterodiol |  OC[C@H](CC1=CC(O)=CC=C1)[C@H](CO)CC1=CC(O)=CC=C1 | 302.151809188 | C18H22O4 | (Poly)phenol metabolites | Lignan metabolites | Show | ||
| Enterolactone |  OC1=CC=CC(C[C@@H]2COC(=O)[C@H]2CC2=CC(O)=CC=C2)=C1 | 298.12050906 | C18H18O4 | (Poly)phenol metabolites | Lignan metabolites | Show | ||
| Allyl isothiocyanate-N-acetyl-L-cysteine |  | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Show | ||||
| Trigonelline | C[N+]1=CC=CC(=C1)C([O-])=O | 137.047678469 | C7H7NO2 | N-containing compounds | Alkaloids | Show |
Biomarkers of intake
No Biomarkers of intake found