Horseradish
- Group:
- Herbs and Spices
Showing entry for Horseradish
Identification
- Name
- Horseradish
- Food group
- Herbs and Spices
External Links
- ITIS
- 23044
Compounds
Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
---|---|---|---|---|---|---|---|---|
Gluconasturtiin | OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS([O-])(=O)=O)C(O)[C@@H](O)[C@@H]1O | 422.058497156 | C15H20NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Sinigrin | OCC1O[C@@H](S\C(CC=C)=N\OS([O-])(=O)=O)C(O)[C@@H](O)[C@@H]1O | 358.027197027 | C10H16NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Allyl isothiocyanate | C=CCN=C=S | 99.014269855 | C4H5NS | N-containing compounds | Isothiocyanates | Publications | Show | |
Phenethyl isothiocyanate | S=C=NCCC1=CC=CC=C1 | 163.045569983 | C9H9NS | N-containing compounds | Isothiocyanates | Publications | Show | |
Glucocapparin | C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 332.011546963 | C8H14NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoputranjivin | CC(C)C(\S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 360.042847092 | C10H18NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Gluconapin | OCC1O[C@@H](S\C(CCC=C)=N\OS([O-])(=O)=O)C(O)[C@@H](O)[C@@H]1O | 372.042847092 | C11H18NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucobrassicanapin | OCC1O[C@@H](S\C(CCCC=C)=N\OS([O-])(=O)=O)C(O)[C@@H](O)[C@@H]1O | 386.058497156 | C12H20NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucotropaeolin | OCC1O[C@@H](S\C(CC2=CC=CC=C2)=N\OS([O-])(=O)=O)C(O)[C@@H](O)[C@@H]1O | 408.042847092 | C14H18NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoiberverin | CSCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 406.03056833 | C11H20NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoberteroin | CSCCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 434.061868459 | C13H24NO9S3 | N-containing compounds | Glucosinolates | Publications | Show |