Lentils
- Group:
- Pulses and beans
Showing entry for Lentils
Identification
- Name
- Lentils
- Food group
- Pulses and beans
Compounds
Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
---|---|---|---|---|---|---|---|---|
Soyasaponin I | [H][C@@]12CC(C)(C)C[C@@H](O)[C@]1(C)CC[C@]1(C)C2=CC[C@]2([H])[C@@]3(C)CC[C@H](O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)C(O)=O)[C@](C)(CO)[C@]3([H])CC[C@@]12C | 942.518815672 | C48H78O18 | Terpenoids | Triterpenoids | Publications | Show | |
2'-Hydroxydaidzein | OC1=CC(O)=C(C=C1)C1=COC2=C(C=CC(O)=C2)C1=O | 270.05282343 | C15H10O5 | Polyphenols | Flavonoids | Publications | Show | |
Agmatine | NCCCCNC(N)=N | 130.121846468 | C5H14N4 | N-containing compounds | Amines | Publications | Show | |
Cadaverine | NCCCCCN | 102.115698458 | C5H14N2 | N-containing compounds | Amines | Publications | Show | |
Putrescine | NCCCCN | 88.100048394 | C4H12N2 | N-containing compounds | Amines | Publications | Show | |
Spermidine | NCCCCNCCCN | 145.157897623 | C7H19N3 | N-containing compounds | Amines | Publications | Show | |
Spermine | NCCCNCCCCNCCCN | 202.215746852 | C10H26N4 | N-containing compounds | Amines | Publications | Show | |
Trigonelline | C[N+]1=CC(=CC=C1)C([O-])=O | 137.047678473 | C7H7NO2 | N-containing compounds | Alkaloids | Publications | Show |