Lentils
- Group:
- Pulses and beans
Showing entry for Lentils
Identification
- Name
- Lentils
- Food group
- Pulses and beans
Compounds
| Name | Structure | Monoisotopic mass/Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|
| Soyasaponin I |  InChI=1S/C48H78O18/c1-21-29(52)31(54)35(58)40(61-21)65-37-32(55)30(53)24(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-12-13-45(5)25(46(28,6)20-50)11-14-48(8)26(45)10-9-22-23-17-43(2,3)18-27(51)44(23,4)15-16-47(22,48)7/h9,21,23-38,40-42,49-58H,10-20H2,1-8H3,(H,59,60)/t21-,23-,24+,25+,26+,27+,28-,29-,30-,31+,32-,33-,34-,35+,36-,37+,38+,40-,41-,42+,44+,45-,46+,47+,48+/m0/s1 | 942.518815672 C48H78O18 | Terpenoids | Triterpenoids | Publications | Show | |
| 2'-Hydroxydaidzein |  InChI=1S/C15H10O5/c16-8-1-3-10(13(18)5-8)12-7-20-14-6-9(17)2-4-11(14)15(12)19/h1-7,16-18H | 270.05282343 C15H10O5 | Polyphenols | Flavonoids | Publications | Show | |
| Agmatine |  InChI=1S/C5H14N4/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H4,7,8,9) | 130.121846468 C5H14N4 | N-containing compounds | Amines | Publications | Show | |
| Cadaverine |  InChI=1S/C5H14N2/c6-4-2-1-3-5-7/h1-7H2 | 102.115698458 C5H14N2 | N-containing compounds | Amines | Publications | Show | |
| Putrescine |  InChI=1S/C4H12N2/c5-3-1-2-4-6/h1-6H2 | 88.100048394 C4H12N2 | N-containing compounds | Amines | Publications | Show | |
| Spermidine |  InChI=1S/C7H19N3/c8-4-1-2-6-10-7-3-5-9/h10H,1-9H2 | 145.157897623 C7H19N3 | N-containing compounds | Amines | Publications | Show | |
| Spermine |  InChI=1S/C10H26N4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12/h13-14H,1-12H2 | 202.215746852 C10H26N4 | N-containing compounds | Amines | Publications | Show | |
| Trigonelline |  InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 | 137.047678473 C7H7NO2 | N-containing compounds | Alkaloids | Publications | Show |