Swede (Rutabaga)
- Group:
- Vegetables, Root vegetables
Showing entry for Swede (Rutabaga)
Identification
- Name
- Swede (Rutabaga)
- ID
- 144
- Food group
- Vegetables, Root vegetables
Synonyms
No Synonyms
Compounds
| Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|---|
| Campesterol | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](C)C(C)C | 400.370516166 | C28H48O | Terpenoids | Phytosterols | Publications | Show | |
| Neoglucobrassicin | CON1C=C(C\C(S[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)=N/OS(O)(=O)=O)C2=C1C=CC=C2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Progoitrin | [H][C@@](O)(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O)C=C | 389.045038164 | C11H19NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapoleiferin | [H][C@](O)(CC=C)C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 403.060688228 | C12H21NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconasturtiin | OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 423.065773608 | C15H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Tryptamine | NCCC1=CNC2=C1C=CC=C2 | 160.100048394 | C10H12N2 | N-containing compounds | Amines | Publications | Show | |
| 4-Methoxyglucobrassicin | COC1=CC=CC2=C1C(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O)=CN2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoraphanin | CS(=O)CCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 437.048409467 | C12H23NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoerucin | CSCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 421.053494847 | C12H23NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoalyssin | CS(=O)CCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 451.064059531 | C13H25NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapin | OCC1O[C@@H](S\C(CCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 373.050123544 | C11H19NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 448.06102258 | C16H20N2O9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicanapin | OCC1O[C@@H](S\C(CCCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 387.065773608 | C12H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show |
Biomarkers of intake
No Biomarkers of intake found