Capers
- Group:
- Herbs and Spices
Showing entry for Capers
Identification
- Name
- Capers
- ID
- 185
- Food group
- Herbs and Spices
Synonyms
No Synonyms
External Links
- ITIS
- 505885
Compounds
| Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|---|
| Progoitrin | [H][C@@](O)(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O)C=C | 389.045038164 | C11H19NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapoleiferin | [H][C@](O)(CC=C)C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 403.060688228 | C12H21NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconasturtiin | OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 423.065773608 | C15H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Sinigrin | OCC1O[C@@H](S\C(CC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 359.034473479 | C10H17NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoiberin | CS(=O)CCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 423.032759402 | C11H21NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| 4-Hydroxyglucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C(O)=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 464.0559372 | C16H20N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoalyssin | CS(=O)CCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 451.064059531 | C13H25NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapin | OCC1O[C@@H](S\C(CCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 373.050123544 | C11H19NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 448.06102258 | C16H20N2O9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucocapparin | C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 333.018823415 | C8H15NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicanapin | OCC1O[C@@H](S\C(CCCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 387.065773608 | C12H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Secoisolariciresinol | COC1=C(O)C=CC(C[C@@H](CO)[C@H](CO)CC2=CC(OC)=C(O)C=C2)=C1 | 362.172938557 | C20H26O6 | Polyphenols | Lignans | Publications | Show | |
| (+)-Matairesinol | COC1=C(O)C=CC(C[C@H]2COC(=O)[C@@H]2CC2=CC(OC)=C(O)C=C2)=C1 | 358.141638428 | C20H22O6 | Polyphenols | Lignans | Publications | Show |
Biomarkers of intake
No Biomarkers of intake found