Radish
- Group:
- Vegetables, Root vegetables
Showing entry for Radish
Identification
- Name
- Radish
- ID
- 254
- Food group
- Vegetables, Root vegetables
Synonyms
No Synonyms
External Links
- ITIS
- 23290
Compounds
Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
---|---|---|---|---|---|---|---|---|
Glucoiberverin | CSCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 407.037844782 | C11H21NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoerucin | CSCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 421.053494847 | C12H23NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoberteroin | CSCCCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O | 435.069144911 | C13H25NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucoraphenin | CS(=O)\C=C\CC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 434.02548295 | C12H20NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucotropaeolin | OCC1O[C@@H](S\C(CC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 409.050123544 | C14H19NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Gluconasturtiin | OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 423.065773608 | C15H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Glucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 448.06102258 | C16H20N2O9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
Sinalbin | OCC1O[C@@H](S\C(CC2=CC=C(O)C=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 425.045038164 | C14H19NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
4-Methylthio-3-butenyl isothiocyanate | CS\C=C\CCN=C=S | 159.017641642 | C6H9NS2 | N-containing compounds | Isothiocyanates | Publications | Show | |
Glucoraphasatin | CS\C=C\CC\C(S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)=N\OS(O)(=O)=O | 419.037844782 | C12H21NO9S3 | N-containing compounds | Glucosinolates | Publications | Show | |
Sulforaphane-N-acetyl-L-cysteine | CC(=O)NC(CSC(=S)NCCCCS(C)=O)C(O)=O | 340.058520654 | C11H20N2O4S3 | N-containing compound metabolites | Glucosinolate and isothiocyanate metabolites | Publications | Show | |
3,3′-Diindolylmethane | C(C1=CNC2=C1C=CC=C2)C1=CNC2=C1C=CC=C2 | 246.115698459 | C17H14N2 | N-containing compound metabolites | Miscellaneous N-containing compound metabolites | Publications | Show | |
Sulforaphene | CS(=O)\C=C\CCN=C=S | 175.012556262 | C6H9NOS2 | N-containing compounds | Isothiocyanates | Publications | Show | |
Phylloquinone | CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC1=C(C)C(=O)C2=CC=CC=C2C1=O | 450.349780721 | C31H46O2 | Terpenoids | Diterpenoids | Publications | Show |
Biomarkers of intake
No Biomarkers of intake found