Cabbage, red
- Group:
- Vegetables, Cabbages
Showing entry for Cabbage, red
Identification
- Name
- Cabbage, red
- ID
- 349
- Food group
- Vegetables, Cabbages
Synonyms
No Synonyms
External Links
No external links
Compounds
| Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
|---|---|---|---|---|---|---|---|---|
| Neoglucobrassicin | CON1C=C(C\C(S[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)=N/OS(O)(=O)=O)C2=C1C=CC=C2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Progoitrin | [H][C@@](O)(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O)C=C | 388.037761712 | C11H18NO10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconasturtiin | OCC1O[C@@H](S\C(CCC2=CC=CC=C2)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 423.065773608 | C15H21NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Sinigrin | OCC1O[C@@H](S\C(CC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 359.034473479 | C10H17NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoiberin | CS(=O)CCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 422.02548295 | C11H20NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| 4-Hydroxyglucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C(O)=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 464.0559372 | C16H20N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| 4-Methoxyglucobrassicin | COC1=CC=CC2=C1C(C\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS(O)(=O)=O)=CN2 | 478.071587264 | C17H22N2O10S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoraphenin | CS(=O)\C=C\CC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 434.02548295 | C12H20NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucoraphanin | CS(=O)CCCC\C(S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)=N/OS([O-])(=O)=O | 436.041133014 | C12H22NO10S3 | N-containing compounds | Glucosinolates | Publications | Show | |
| Gluconapin | OCC1O[C@@H](S\C(CCC=C)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 373.050123544 | C11H19NO9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Glucobrassicin | OCC1O[C@@H](S\C(CC2=CNC3=C2C=CC=C3)=N\OS(O)(=O)=O)C(O)[C@@H](O)[C@@H]1O | 448.06102258 | C16H20N2O9S2 | N-containing compounds | Glucosinolates | Publications | Show | |
| Iberin N-acetyl-cysteine | [H][C@@](CSC(S)=NCCCS(C)=O)(N=C(C)O)C(O)=O | 326.04287059 | C10H18N2O4S3 | N-containing compounds | Isothiocyanates | Publications | Show |
Biomarkers of intake
No Biomarkers of intake found