Swiss chard
- Group:
- Vegetables, Leaf vegetables
Showing entry for Swiss chard
Identification
- Name
- Swiss chard
- ID
- 273
- Food group
- Vegetables, Leaf vegetables
Synonyms
No Synonyms
External Links
- ITIS
- 524868
Compounds
Name | Structure | Monoisotopic mass | Formula | Family | Class | |||
---|---|---|---|---|---|---|---|---|
tyrosine-betaxanthin | OC(=O)[C@H](CC1=CC=C(O)C=C1)N\C=C\C1=CC(=N[C@@H](C1)C(O)=O)C(O)=O | 374.111400928 | C18H18N2O7 | N-containing compounds | Alkaloids | Publications | Show | |
Serine-betaxantin | OC[C@H](\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O)C(O)=O | 298.080100799 | C12H14N2O7 | N-containing compounds | Alkaloids | Publications | Show | |
Histamine-betaxanthin | [H][C@]1(C\C(=C/C=N\CCC2=CN=CN2)C=C(N1)C(O)=O)C(O)=O | 304.117155011 | C14H16N4O4 | N-containing compounds | Alkaloids | Publications | Show | |
Phenylalanine-betaxanthin | [H][C@]1(C\C(=C/C=N\[C@@H](CC2=CC=CC=C2)C(O)=O)C=C(N1)C(O)=O)C(O)=O | 358.116486308 | C18H18N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
γ-Aminobutyric acid-betaxanthin | OC(=O)CCC\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O | 296.100836243 | C13H16N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Valine-betaxanthin | CC(C)[C@H](\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O)C(O)=O | 310.116486308 | C14H18N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
3-Methoxy-tyramine-betaxanthin | [H][C@]1(C\C(=C/C=N\CCC2=CC(OC)=C(O)C=C2)C=C(N1)C(O)=O)C(O)=O | 360.132136372 | C18H20N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Isoleucine-betaxanthin | [H][C@]1(C\C(=C/C=NC(C(C)CC)C(O)=O)C=C(N1)C(O)=O)C(O)=O | 324.132136372 | C15H20N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Tryptophan-betaxanthin | OC(=O)[C@H](CC1=CNC2=CC=CC=C12)\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O | 397.127385344 | C20H19N3O6 | N-containing compounds | Alkaloids | Publications | Show | |
Betanin | OC[C@H]1O[C@@H](OC2=CC3=C(C=C2O)\[N+](=C\C=C2/C[C@H](NC(=C2)C(O)=O)C(O)=O)[C@@H](C3)C([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O | 550.143488905 | C24H26N2O13 | N-containing compounds | Alkaloids | Publications | Show | |
Isobetanin | OC[C@H]1O[C@@H](OC2=C(O)C=C3C(C[C@@H](C([O-])=O)\[N+]3=C/C=C3\C[C@@H](NC(=C3)C(O)=O)C(O)=O)=C2)[C@H](O)[C@@H](O)[C@@H]1O | 550.143488905 | C24H26N2O13 | N-containing compounds | Alkaloids | Publications | Show | |
Betanidin | OC(=O)[C@H]1C\C(=C\C=[N+]2\[C@H](CC3=C2C=C(O)C(O)=C3)C([O-])=O)C=C(N1)C(O)=O | 388.090665483 | C18H16N2O8 | N-containing compounds | Alkaloids | Publications | Show | |
Isobetanidin | [H]N1C(=C\C(C[C@@]1([H])C(O)=O)=C(/[H])\C=[N+]1/[C@@H](CC2=CC(O)=C(O)C=C12)C(O)=O)C(O)=O | 389.097941936 | C18H17N2O8 | N-containing compounds | Alkaloids | Publications | Show | |
Phyllocactin | O[C@H]1[C@H](O)[C@@H](OC(=O)CCCC(O)=O)OC(OC2=C(O)C=C3C(C[C@@H](C([O-])=O)\[N+]3=C/C=C3/CC(NC(=C3)C(O)=O)C(O)=O)=C2)[C@@H]1O | 650.159532894 | C28H30N2O16 | N-containing compounds | Alkaloids | Publications | Show | |
Lampranthin II | COC1=C([O-])C=CC(C=CC(=O)OC[C@H]2O[C@@H](OC3=C(O)C=C4C(C[C@@H](C(O)=O)[N+]4=CC=C4C[C@H](NC(=C4)C(O)=O)C(O)=O)=C3)[C@H](O)[C@@H](O)[C@@H]2O)=C1 | 726.190833023 | C34H34N2O16 | N-containing compounds | Alkaloids | Publications | Show | |
Isolampranthin II | [H]N1[C@H](C\C(C=C1C(O)=O)=C(\[H])/C=[N+]1\[C@@H](CC2=CC(OC3O[C@H](COC(=O)\C=C\C4=CC=C(O)C(OC)=C4)[C@@H](O)[C@H](O)[C@H]3O)=C(O)C=C12)C([O-])=O)C(O)=O | 726.190833023 | C34H34N2O16 | N-containing compounds | Alkaloids | Publications | Show | |
Histidine-betaxanthin | [H][C@]1(C\C(=C/C=N\C(CC2=CNC=N2)C(O)=O)C=C(N1)C(O)=O)C(O)=O | 348.106984251 | C15H16N4O6 | N-containing compounds | Alkaloids | Publications | Show | |
Asparagine-betaxanthin | [H][C@]1(C\C(=C/C=N[C@@H](CC(N)=O)C(O)=O)C=C(N1)C(O)=O)C(O)=O | 325.090999835 | C13H15N3O7 | N-containing compounds | Alkaloids | Publications | Show | |
glutamine-betaxanthin | NC(=O)CC[C@H](\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O)C(O)=O | 339.106649899 | C14H17N3O7 | N-containing compounds | Alkaloids | Publications | Show | |
Glycine-betaxanthin | OC(=O)C\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O | 268.069536114 | C11H12N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Glutamic acid-betaxanthin | OC(=O)CC[C@H](N\C=C\C1=CC(=N[C@@H](C1)C(O)=O)C(O)=O)C(O)=O | 340.090665483 | C14H16N2O8 | N-containing compounds | Alkaloids | Publications | Show | |
Proline-betaxanthin | OC(=O)[C@@H]1CCC[N+]1=CC=C1C[C@H](NC(=C1)C([O-])=O)C(O)=O | 308.100836243 | C14H16N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Dopamine-betaxanthin | OC(=O)C1C\C(=C/C=N\CCC2=CC=C(O)C(O)=C2)C=C(N1)C(O)=O | 346.116486308 | C17H18N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Tyramine-betaxanthin | OC(=O)C1C\C(=C/C=N\CCC2=CC=C(O)C=C2)C=C(N1)C(O)=O | 330.121571688 | C17H18N2O5 | N-containing compounds | Alkaloids | Publications | Show | |
Leucine-betaxanthin | [H][C@]1(C\C(=C/C=N/C(CC(C)C)C(O)=O)C=C(N1)C(O)=O)C(O)=O | 324.132136372 | C15H20N2O6 | N-containing compounds | Alkaloids | Publications | Show | |
Alanine-betaxanthin | CC(\N=C/C=C1\C[C@H](NC(=C1)C(O)=O)C(O)=O)C(O)=O | 282.085186179 | C12H14N2O6 | N-containing compounds | Alkaloids | Publications | Show |
Biomarkers of intake
No Biomarkers of intake found